About 2-bromobenzaldehyde;bromobenzene
2-bromobenzaldehyde;bromobenzene (PubChem CID 174648828) has the molecular formula C13H10Br2O
and a molecular weight of 342.03 g/mol. Its IUPAC name is 2-bromobenzaldehyde;bromobenzene.
Molecular Properties
| Compound Name | 2-bromobenzaldehyde;bromobenzene |
| PubChem CID | 174648828 |
| Molecular Formula | C13H10Br2O |
| Molecular Weight | 342.03 g/mol |
| Exact Mass | 339.91 |
| IUPAC Name | 2-bromobenzaldehyde;bromobenzene |
| SMILES | Brc1ccccc1.O=Cc1ccccc1Br |
| InChI | InChI=1S/C7H5BrO.C6H5Br/c8-7-4-2-1-3-6(7)5-9;7-6-4-2-1-3-5-6/h1-5H;1-5H |
| InChIKey | LLDOECTZBMQWGU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.03 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-bromobenzaldehyde;bromobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromobenzaldehyde;bromobenzene?
The IUPAC name of 2-bromobenzaldehyde;bromobenzene (CID 174648828) is 2-bromobenzaldehyde;bromobenzene.
What is the SMILES notation for 2-bromobenzaldehyde;bromobenzene?
The canonical SMILES for 2-bromobenzaldehyde;bromobenzene is Brc1ccccc1.O=Cc1ccccc1Br.
What is the InChIKey of 2-bromobenzaldehyde;bromobenzene?
The InChIKey is LLDOECTZBMQWGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO.C6H5Br/c8-7-4-2-1-3-6(7)5-9;7-6-4-2-1-3-5-6/h1-5H;1-5H.
What are the key properties of 2-bromobenzaldehyde;bromobenzene?
2-bromobenzaldehyde;bromobenzene has a molecular weight of 342.03 g/mol, XLogP of 4.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromobenzaldehyde;bromobenzene is sourced from PubChem (CID 174648828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).