About fluoro 3-methyl-5-(1,3-thiazole-2-carbonyl)benzoate
fluoro 3-methyl-5-(1,3-thiazole-2-carbonyl)benzoate (PubChem CID 174649029) has the molecular formula C12H8FNO3S
and a molecular weight of 265.26 g/mol. Its IUPAC name is fluoro 3-methyl-5-(1,3-thiazole-2-carbonyl)benzoate.
Molecular Properties
| Compound Name | fluoro 3-methyl-5-(1,3-thiazole-2-carbonyl)benzoate |
| PubChem CID | 174649029 |
| Molecular Formula | C12H8FNO3S |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | fluoro 3-methyl-5-(1,3-thiazole-2-carbonyl)benzoate |
| SMILES | Cc1cc(C(=O)OF)cc(C(=O)c2nccs2)c1 |
| InChI | InChI=1S/C12H8FNO3S/c1-7-4-8(6-9(5-7)12(16)17-13)10(15)11-14-2-3-18-11/h2-6H,1H3 |
| InChIKey | GQHKXNCLXBFTQI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze fluoro 3-methyl-5-(1,3-thiazole-2-carbonyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 3-methyl-5-(1,3-thiazole-2-carbonyl)benzoate?
The IUPAC name of fluoro 3-methyl-5-(1,3-thiazole-2-carbonyl)benzoate (CID 174649029) is fluoro 3-methyl-5-(1,3-thiazole-2-carbonyl)benzoate.
What is the SMILES notation for fluoro 3-methyl-5-(1,3-thiazole-2-carbonyl)benzoate?
The canonical SMILES for fluoro 3-methyl-5-(1,3-thiazole-2-carbonyl)benzoate is Cc1cc(C(=O)OF)cc(C(=O)c2nccs2)c1.
What is the InChIKey of fluoro 3-methyl-5-(1,3-thiazole-2-carbonyl)benzoate?
The InChIKey is GQHKXNCLXBFTQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8FNO3S/c1-7-4-8(6-9(5-7)12(16)17-13)10(15)11-14-2-3-18-11/h2-6H,1H3.
What are the key properties of fluoro 3-methyl-5-(1,3-thiazole-2-carbonyl)benzoate?
fluoro 3-methyl-5-(1,3-thiazole-2-carbonyl)benzoate has a molecular weight of 265.26 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 3-methyl-5-(1,3-thiazole-2-carbonyl)benzoate is sourced from PubChem (CID 174649029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).