C29H28ClFN4O4 — CID 174649174
carbamoyl 2-[(3-fluoro-2-methylphenyl)methyl]-1-phenyl-3-(piperazine-1-carbonyl)indolizine-6-carboxylate;hydrochloride (PubChem CID 174649174) has the molecular formula C29H28ClFN4O4 and a molecular weight of 551.02 g/mol. Its IUPAC name is carbamoyl 2-[(3-fluoro-2-methylphenyl)methyl]-1-phenyl-3-(piperazine-1-carbonyl)indolizine-6-carboxylate;hydrochloride.
| Compound Name | carbamoyl 2-[(3-fluoro-2-methylphenyl)methyl]-1-phenyl-3-(piperazine-1-carbonyl)indolizine-6-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 174649174 |
| Molecular Formula | C29H28ClFN4O4 |
| Molecular Weight | 551.02 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | carbamoyl 2-[(3-fluoro-2-methylphenyl)methyl]-1-phenyl-3-(piperazine-1-carbonyl)indolizine-6-carboxylate;hydrochloride |
| SMILES | Cc1c(F)cccc1Cc1c(-c2ccccc2)c2ccc(C(=O)OC(N)=O)cn2c1C(=O)N1CCNCC1.Cl |
| InChI | InChI=1S/C29H27FN4O4.ClH/c1-18-20(8-5-9-23(18)30)16-22-25(19-6-3-2-4-7-19)24-11-10-21(28(36)38-29(31)37)17-34(24)26(22)27(35)33-14-12-32-13-15-33;/h2-11,17,32H,12-16H2,1H3,(H2,31,37);1H |
| InChIKey | HQBWINRUCIEWBZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.02 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|