About 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl acetate
2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl acetate (PubChem CID 174649390) has the molecular formula C8H13N3O4S2
and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl acetate.
Molecular Properties
| Compound Name | 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl acetate |
| PubChem CID | 174649390 |
| Molecular Formula | C8H13N3O4S2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl acetate |
| SMILES | CC(=O)OCCNS(=O)(=O)c1sc(N)nc1C |
| InChI | InChI=1S/C8H13N3O4S2/c1-5-7(16-8(9)11-5)17(13,14)10-3-4-15-6(2)12/h10H,3-4H2,1-2H3,(H2,9,11) |
| InChIKey | MKLUEPAOJCTLIG-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl acetate?
The IUPAC name of 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl acetate (CID 174649390) is 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl acetate.
What is the SMILES notation for 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl acetate?
The canonical SMILES for 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl acetate is CC(=O)OCCNS(=O)(=O)c1sc(N)nc1C.
What is the InChIKey of 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl acetate?
The InChIKey is MKLUEPAOJCTLIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O4S2/c1-5-7(16-8(9)11-5)17(13,14)10-3-4-15-6(2)12/h10H,3-4H2,1-2H3,(H2,9,11).
What are the key properties of 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl acetate?
2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl acetate has a molecular weight of 279.34 g/mol, XLogP of -0.12, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl acetate is sourced from PubChem (CID 174649390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).