C17H26N2O2 — CID 174650285
ethyl (2S)-2-amino-4-[3-(2-iminopentyl)phenyl]butanoate (PubChem CID 174650285) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is ethyl (2S)-2-amino-4-[3-(2-iminopentyl)phenyl]butanoate.
| Compound Name | ethyl (2S)-2-amino-4-[3-(2-iminopentyl)phenyl]butanoate |
|---|---|
| PubChem CID | 174650285 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | ethyl (2S)-2-amino-4-[3-(2-iminopentyl)phenyl]butanoate |
| SMILES | [H]/N=C(\CCC)Cc1cccc(CC[C@H](N)C(=O)OCC)c1 |
| InChI | InChI=1S/C17H26N2O2/c1-3-6-15(18)12-14-8-5-7-13(11-14)9-10-16(19)17(20)21-4-2/h5,7-8,11,16,18H,3-4,6,9-10,12,19H2,1-2H3/b18-15+/t16-/m0/s1 |
| InChIKey | XYQLCVBSTDJZDC-XIGQLOAZSA-N |
| XLogP | 2.87 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|