About 3-ethyloctanoic acid;neodymium
3-ethyloctanoic acid;neodymium (PubChem CID 174650378) has the molecular formula C10H20NdO2
and a molecular weight of 316.51 g/mol. Its IUPAC name is 3-ethyloctanoic acid;neodymium.
Molecular Properties
| Compound Name | 3-ethyloctanoic acid;neodymium |
| PubChem CID | 174650378 |
| Molecular Formula | C10H20NdO2 |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-ethyloctanoic acid;neodymium |
| SMILES | CCCCCC(CC)CC(=O)O.[Nd] |
| InChI | InChI=1S/C10H20O2.Nd/c1-3-5-6-7-9(4-2)8-10(11)12;/h9H,3-8H2,1-2H3,(H,11,12); |
| InChIKey | CSRQZFJAOKZKIR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyloctanoic acid;neodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyloctanoic acid;neodymium?
The IUPAC name of 3-ethyloctanoic acid;neodymium (CID 174650378) is 3-ethyloctanoic acid;neodymium.
What is the SMILES notation for 3-ethyloctanoic acid;neodymium?
The canonical SMILES for 3-ethyloctanoic acid;neodymium is CCCCCC(CC)CC(=O)O.[Nd].
What is the InChIKey of 3-ethyloctanoic acid;neodymium?
The InChIKey is CSRQZFJAOKZKIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.Nd/c1-3-5-6-7-9(4-2)8-10(11)12;/h9H,3-8H2,1-2H3,(H,11,12);.
What are the key properties of 3-ethyloctanoic acid;neodymium?
3-ethyloctanoic acid;neodymium has a molecular weight of 316.51 g/mol, XLogP of 3.07, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyloctanoic acid;neodymium is sourced from PubChem (CID 174650378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).