About 7-propan-2-yl-2-[(2-propan-2-ylphenyl)methyl]-1,9-dihydrofluoren-1-ide;titanium
7-propan-2-yl-2-[(2-propan-2-ylphenyl)methyl]-1,9-dihydrofluoren-1-ide;titanium (PubChem CID 174651744) has the molecular formula C26H27Ti-
and a molecular weight of 387.37 g/mol. Its IUPAC name is 7-propan-2-yl-2-[(2-propan-2-ylphenyl)methyl]-1,9-dihydrofluoren-1-ide;titanium.
Molecular Properties
| Compound Name | 7-propan-2-yl-2-[(2-propan-2-ylphenyl)methyl]-1,9-dihydrofluoren-1-ide;titanium |
| PubChem CID | 174651744 |
| Molecular Formula | C26H27Ti- |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 7-propan-2-yl-2-[(2-propan-2-ylphenyl)methyl]-1,9-dihydrofluoren-1-ide;titanium |
| SMILES | CC(C)c1ccc2c(c1)Cc1[c-]c(Cc3ccccc3C(C)C)ccc1-2.[Ti] |
| InChI | InChI=1S/C26H27.Ti/c1-17(2)20-10-12-26-23(15-20)16-22-14-19(9-11-25(22)26)13-21-7-5-6-8-24(21)18(3)4;/h5-12,15,17-18H,13,16H2,1-4H3;/q-1; |
| InChIKey | CCBHLAKNQRWXLP-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 7-propan-2-yl-2-[(2-propan-2-ylphenyl)methyl]-1,9-dihydrofluoren-1-ide;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propan-2-yl-2-[(2-propan-2-ylphenyl)methyl]-1,9-dihydrofluoren-1-ide;titanium?
The IUPAC name of 7-propan-2-yl-2-[(2-propan-2-ylphenyl)methyl]-1,9-dihydrofluoren-1-ide;titanium (CID 174651744) is 7-propan-2-yl-2-[(2-propan-2-ylphenyl)methyl]-1,9-dihydrofluoren-1-ide;titanium.
What is the SMILES notation for 7-propan-2-yl-2-[(2-propan-2-ylphenyl)methyl]-1,9-dihydrofluoren-1-ide;titanium?
The canonical SMILES for 7-propan-2-yl-2-[(2-propan-2-ylphenyl)methyl]-1,9-dihydrofluoren-1-ide;titanium is CC(C)c1ccc2c(c1)Cc1[c-]c(Cc3ccccc3C(C)C)ccc1-2.[Ti].
What is the InChIKey of 7-propan-2-yl-2-[(2-propan-2-ylphenyl)methyl]-1,9-dihydrofluoren-1-ide;titanium?
The InChIKey is CCBHLAKNQRWXLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27.Ti/c1-17(2)20-10-12-26-23(15-20)16-22-14-19(9-11-25(22)26)13-21-7-5-6-8-24(21)18(3)4;/h5-12,15,17-18H,13,16H2,1-4H3;/q-1;.
What are the key properties of 7-propan-2-yl-2-[(2-propan-2-ylphenyl)methyl]-1,9-dihydrofluoren-1-ide;titanium?
7-propan-2-yl-2-[(2-propan-2-ylphenyl)methyl]-1,9-dihydrofluoren-1-ide;titanium has a molecular weight of 387.37 g/mol, XLogP of 6.89, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propan-2-yl-2-[(2-propan-2-ylphenyl)methyl]-1,9-dihydrofluoren-1-ide;titanium is sourced from PubChem (CID 174651744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).