About (3-ethyl-1,1,2-trimethoxy-4-methyl-2-propylsilinan-3-yl)phosphane
(3-ethyl-1,1,2-trimethoxy-4-methyl-2-propylsilinan-3-yl)phosphane (PubChem CID 174652061) has the molecular formula C14H31O3PSi
and a molecular weight of 306.46 g/mol. Its IUPAC name is (3-ethyl-1,1,2-trimethoxy-4-methyl-2-propylsilinan-3-yl)phosphane.
Molecular Properties
| Compound Name | (3-ethyl-1,1,2-trimethoxy-4-methyl-2-propylsilinan-3-yl)phosphane |
| PubChem CID | 174652061 |
| Molecular Formula | C14H31O3PSi |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (3-ethyl-1,1,2-trimethoxy-4-methyl-2-propylsilinan-3-yl)phosphane |
| SMILES | CCCC1(OC)C(P)(CC)C(C)CC[Si]1(OC)OC |
| InChI | InChI=1S/C14H31O3PSi/c1-7-10-14(15-4)13(18,8-2)12(3)9-11-19(14,16-5)17-6/h12H,7-11,18H2,1-6H3 |
| InChIKey | FZMQJBTUWQHVOO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-ethyl-1,1,2-trimethoxy-4-methyl-2-propylsilinan-3-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-1,1,2-trimethoxy-4-methyl-2-propylsilinan-3-yl)phosphane?
The IUPAC name of (3-ethyl-1,1,2-trimethoxy-4-methyl-2-propylsilinan-3-yl)phosphane (CID 174652061) is (3-ethyl-1,1,2-trimethoxy-4-methyl-2-propylsilinan-3-yl)phosphane.
What is the SMILES notation for (3-ethyl-1,1,2-trimethoxy-4-methyl-2-propylsilinan-3-yl)phosphane?
The canonical SMILES for (3-ethyl-1,1,2-trimethoxy-4-methyl-2-propylsilinan-3-yl)phosphane is CCCC1(OC)C(P)(CC)C(C)CC[Si]1(OC)OC.
What is the InChIKey of (3-ethyl-1,1,2-trimethoxy-4-methyl-2-propylsilinan-3-yl)phosphane?
The InChIKey is FZMQJBTUWQHVOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31O3PSi/c1-7-10-14(15-4)13(18,8-2)12(3)9-11-19(14,16-5)17-6/h12H,7-11,18H2,1-6H3.
What are the key properties of (3-ethyl-1,1,2-trimethoxy-4-methyl-2-propylsilinan-3-yl)phosphane?
(3-ethyl-1,1,2-trimethoxy-4-methyl-2-propylsilinan-3-yl)phosphane has a molecular weight of 306.46 g/mol, XLogP of 3.51, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-1,1,2-trimethoxy-4-methyl-2-propylsilinan-3-yl)phosphane is sourced from PubChem (CID 174652061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).