About N,N-dimethylformamide;2-(2-sulfanylphenyl)sulfanylbenzenethiol
N,N-dimethylformamide;2-(2-sulfanylphenyl)sulfanylbenzenethiol (PubChem CID 174652487) has the molecular formula C15H17NOS3
and a molecular weight of 323.51 g/mol. Its IUPAC name is N,N-dimethylformamide;2-(2-sulfanylphenyl)sulfanylbenzenethiol.
Molecular Properties
| Compound Name | N,N-dimethylformamide;2-(2-sulfanylphenyl)sulfanylbenzenethiol |
| PubChem CID | 174652487 |
| Molecular Formula | C15H17NOS3 |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | N,N-dimethylformamide;2-(2-sulfanylphenyl)sulfanylbenzenethiol |
| SMILES | CN(C)C=O.Sc1ccccc1Sc1ccccc1S |
| InChI | InChI=1S/C12H10S3.C3H7NO/c13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14;1-4(2)3-5/h1-8,13-14H;3H,1-2H3 |
| InChIKey | RUSCAFGREKPONP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;2-(2-sulfanylphenyl)sulfanylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;2-(2-sulfanylphenyl)sulfanylbenzenethiol?
The IUPAC name of N,N-dimethylformamide;2-(2-sulfanylphenyl)sulfanylbenzenethiol (CID 174652487) is N,N-dimethylformamide;2-(2-sulfanylphenyl)sulfanylbenzenethiol.
What is the SMILES notation for N,N-dimethylformamide;2-(2-sulfanylphenyl)sulfanylbenzenethiol?
The canonical SMILES for N,N-dimethylformamide;2-(2-sulfanylphenyl)sulfanylbenzenethiol is CN(C)C=O.Sc1ccccc1Sc1ccccc1S.
What is the InChIKey of N,N-dimethylformamide;2-(2-sulfanylphenyl)sulfanylbenzenethiol?
The InChIKey is RUSCAFGREKPONP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S3.C3H7NO/c13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14;1-4(2)3-5/h1-8,13-14H;3H,1-2H3.
What are the key properties of N,N-dimethylformamide;2-(2-sulfanylphenyl)sulfanylbenzenethiol?
N,N-dimethylformamide;2-(2-sulfanylphenyl)sulfanylbenzenethiol has a molecular weight of 323.51 g/mol, XLogP of 4.12, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;2-(2-sulfanylphenyl)sulfanylbenzenethiol is sourced from PubChem (CID 174652487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).