C12F6N2O2 — CID 174652908
2,3,5,6,7,8-hexafluoro-1,4-dioxonaphthalene-2,3-dicarbonitrile (PubChem CID 174652908) has the molecular formula C12F6N2O2 and a molecular weight of 318.13 g/mol. Its IUPAC name is 2,3,5,6,7,8-hexafluoro-1,4-dioxonaphthalene-2,3-dicarbonitrile.
| Compound Name | 2,3,5,6,7,8-hexafluoro-1,4-dioxonaphthalene-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 174652908 |
| Molecular Formula | C12F6N2O2 |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 2,3,5,6,7,8-hexafluoro-1,4-dioxonaphthalene-2,3-dicarbonitrile |
| SMILES | N#CC1(F)C(=O)c2c(F)c(F)c(F)c(F)c2C(=O)C1(F)C#N |
| InChI | InChI=1S/C12F6N2O2/c13-5-3-4(6(14)8(16)7(5)15)10(22)12(18,2-20)11(17,1-19)9(3)21 |
| InChIKey | ZXILQNSFHICTPS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|