About barium(2+);dioxozirconium;sulfate
barium(2+);dioxozirconium;sulfate (PubChem CID 174654416) has the molecular formula BaO6SZr
and a molecular weight of 356.61 g/mol. Its IUPAC name is barium(2+);dioxozirconium;sulfate.
Molecular Properties
| Compound Name | barium(2+);dioxozirconium;sulfate |
| PubChem CID | 174654416 |
| Molecular Formula | BaO6SZr |
| Molecular Weight | 356.61 g/mol |
| Exact Mass | 355.75 |
| IUPAC Name | barium(2+);dioxozirconium;sulfate |
| SMILES | O=S(=O)([O-])[O-].O=[Zr]=O.[Ba+2] |
| InChI | InChI=1S/Ba.H2O4S.2O.Zr/c;1-5(2,3)4;;;/h;(H2,1,2,3,4);;;/q+2;;;;/p-2 |
| InChIKey | FIEJHMCYPQLPAU-UHFFFAOYSA-L |
| XLogP | -1.96 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.61 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);dioxozirconium;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);dioxozirconium;sulfate?
The IUPAC name of barium(2+);dioxozirconium;sulfate (CID 174654416) is barium(2+);dioxozirconium;sulfate.
What is the SMILES notation for barium(2+);dioxozirconium;sulfate?
The canonical SMILES for barium(2+);dioxozirconium;sulfate is O=S(=O)([O-])[O-].O=[Zr]=O.[Ba+2].
What is the InChIKey of barium(2+);dioxozirconium;sulfate?
The InChIKey is FIEJHMCYPQLPAU-UHFFFAOYSA-L. The full InChI is InChI=1S/Ba.H2O4S.2O.Zr/c;1-5(2,3)4;;;/h;(H2,1,2,3,4);;;/q+2;;;;/p-2.
What are the key properties of barium(2+);dioxozirconium;sulfate?
barium(2+);dioxozirconium;sulfate has a molecular weight of 356.61 g/mol, XLogP of -1.96, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);dioxozirconium;sulfate is sourced from PubChem (CID 174654416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).