C9H11ClS — CID 174655040
2-chloro-5-(2-ethylcyclopropyl)thiophene (PubChem CID 174655040) has the molecular formula C9H11ClS and a molecular weight of 186.71 g/mol. Its IUPAC name is 2-chloro-5-(2-ethylcyclopropyl)thiophene.
| Compound Name | 2-chloro-5-(2-ethylcyclopropyl)thiophene |
|---|---|
| PubChem CID | 174655040 |
| Molecular Formula | C9H11ClS |
| Molecular Weight | 186.71 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 2-chloro-5-(2-ethylcyclopropyl)thiophene |
| SMILES | CCC1CC1c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H11ClS/c1-2-6-5-7(6)8-3-4-9(10)11-8/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | BONUTBWDXYTZJT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.71 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |