About [4-(difluoromethyl)-1,3-thiazol-2-yl] N-tert-butylcarbamate
[4-(difluoromethyl)-1,3-thiazol-2-yl] N-tert-butylcarbamate (PubChem CID 174655842) has the molecular formula C9H12F2N2O2S
and a molecular weight of 250.27 g/mol. Its IUPAC name is [4-(difluoromethyl)-1,3-thiazol-2-yl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [4-(difluoromethyl)-1,3-thiazol-2-yl] N-tert-butylcarbamate |
| PubChem CID | 174655842 |
| Molecular Formula | C9H12F2N2O2S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | [4-(difluoromethyl)-1,3-thiazol-2-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)Oc1nc(C(F)F)cs1 |
| InChI | InChI=1S/C9H12F2N2O2S/c1-9(2,3)13-7(14)15-8-12-5(4-16-8)6(10)11/h4,6H,1-3H3,(H,13,14) |
| InChIKey | REXNCXHBNQBQPP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(difluoromethyl)-1,3-thiazol-2-yl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(difluoromethyl)-1,3-thiazol-2-yl] N-tert-butylcarbamate?
The IUPAC name of [4-(difluoromethyl)-1,3-thiazol-2-yl] N-tert-butylcarbamate (CID 174655842) is [4-(difluoromethyl)-1,3-thiazol-2-yl] N-tert-butylcarbamate.
What is the SMILES notation for [4-(difluoromethyl)-1,3-thiazol-2-yl] N-tert-butylcarbamate?
The canonical SMILES for [4-(difluoromethyl)-1,3-thiazol-2-yl] N-tert-butylcarbamate is CC(C)(C)NC(=O)Oc1nc(C(F)F)cs1.
What is the InChIKey of [4-(difluoromethyl)-1,3-thiazol-2-yl] N-tert-butylcarbamate?
The InChIKey is REXNCXHBNQBQPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2N2O2S/c1-9(2,3)13-7(14)15-8-12-5(4-16-8)6(10)11/h4,6H,1-3H3,(H,13,14).
What are the key properties of [4-(difluoromethyl)-1,3-thiazol-2-yl] N-tert-butylcarbamate?
[4-(difluoromethyl)-1,3-thiazol-2-yl] N-tert-butylcarbamate has a molecular weight of 250.27 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(difluoromethyl)-1,3-thiazol-2-yl] N-tert-butylcarbamate is sourced from PubChem (CID 174655842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).