C9H12N2O4 — CID 174656005
(2-amino-4,6-dimethoxy-3-pyridinyl)methyl formate (PubChem CID 174656005) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is (2-amino-4,6-dimethoxy-3-pyridinyl)methyl formate.
| Compound Name | (2-amino-4,6-dimethoxy-3-pyridinyl)methyl formate |
|---|---|
| PubChem CID | 174656005 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (2-amino-4,6-dimethoxy-3-pyridinyl)methyl formate |
| SMILES | COc1cc(OC)c(COC=O)c(N)n1 |
| InChI | InChI=1S/C9H12N2O4/c1-13-7-3-8(14-2)11-9(10)6(7)4-15-5-12/h3,5H,4H2,1-2H3,(H2,10,11) |
| InChIKey | XXMVQRUOJVRKKH-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|