About 2-methylpropanoic acid;2H-pyridine-1-carboxylic acid
2-methylpropanoic acid;2H-pyridine-1-carboxylic acid (PubChem CID 174656079) has the molecular formula C10H15NO4
and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-methylpropanoic acid;2H-pyridine-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-methylpropanoic acid;2H-pyridine-1-carboxylic acid |
| PubChem CID | 174656079 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-methylpropanoic acid;2H-pyridine-1-carboxylic acid |
| SMILES | CC(C)C(=O)O.O=C(O)N1C=CC=CC1 |
| InChI | InChI=1S/C6H7NO2.C4H8O2/c8-6(9)7-4-2-1-3-5-7;1-3(2)4(5)6/h1-4H,5H2,(H,8,9);3H,1-2H3,(H,5,6) |
| InChIKey | ADLURJRMCPYIAF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpropanoic acid;2H-pyridine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanoic acid;2H-pyridine-1-carboxylic acid?
The IUPAC name of 2-methylpropanoic acid;2H-pyridine-1-carboxylic acid (CID 174656079) is 2-methylpropanoic acid;2H-pyridine-1-carboxylic acid.
What is the SMILES notation for 2-methylpropanoic acid;2H-pyridine-1-carboxylic acid?
The canonical SMILES for 2-methylpropanoic acid;2H-pyridine-1-carboxylic acid is CC(C)C(=O)O.O=C(O)N1C=CC=CC1.
What is the InChIKey of 2-methylpropanoic acid;2H-pyridine-1-carboxylic acid?
The InChIKey is ADLURJRMCPYIAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2.C4H8O2/c8-6(9)7-4-2-1-3-5-7;1-3(2)4(5)6/h1-4H,5H2,(H,8,9);3H,1-2H3,(H,5,6).
What are the key properties of 2-methylpropanoic acid;2H-pyridine-1-carboxylic acid?
2-methylpropanoic acid;2H-pyridine-1-carboxylic acid has a molecular weight of 213.23 g/mol, XLogP of 1.78, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanoic acid;2H-pyridine-1-carboxylic acid is sourced from PubChem (CID 174656079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).