About 1-cyclohexylpyrrolidin-2-one;1,3-oxazolidin-2-one
1-cyclohexylpyrrolidin-2-one;1,3-oxazolidin-2-one (PubChem CID 174656528) has the molecular formula C13H22N2O3
and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-cyclohexylpyrrolidin-2-one;1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 1-cyclohexylpyrrolidin-2-one;1,3-oxazolidin-2-one |
| PubChem CID | 174656528 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-cyclohexylpyrrolidin-2-one;1,3-oxazolidin-2-one |
| SMILES | O=C1CCCN1C1CCCCC1.O=C1NCCO1 |
| InChI | InChI=1S/C10H17NO.C3H5NO2/c12-10-7-4-8-11(10)9-5-2-1-3-6-9;5-3-4-1-2-6-3/h9H,1-8H2;1-2H2,(H,4,5) |
| InChIKey | CZXYSCVVHJCBIO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexylpyrrolidin-2-one;1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylpyrrolidin-2-one;1,3-oxazolidin-2-one?
The IUPAC name of 1-cyclohexylpyrrolidin-2-one;1,3-oxazolidin-2-one (CID 174656528) is 1-cyclohexylpyrrolidin-2-one;1,3-oxazolidin-2-one.
What is the SMILES notation for 1-cyclohexylpyrrolidin-2-one;1,3-oxazolidin-2-one?
The canonical SMILES for 1-cyclohexylpyrrolidin-2-one;1,3-oxazolidin-2-one is O=C1CCCN1C1CCCCC1.O=C1NCCO1.
What is the InChIKey of 1-cyclohexylpyrrolidin-2-one;1,3-oxazolidin-2-one?
The InChIKey is CZXYSCVVHJCBIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO.C3H5NO2/c12-10-7-4-8-11(10)9-5-2-1-3-6-9;5-3-4-1-2-6-3/h9H,1-8H2;1-2H2,(H,4,5).
What are the key properties of 1-cyclohexylpyrrolidin-2-one;1,3-oxazolidin-2-one?
1-cyclohexylpyrrolidin-2-one;1,3-oxazolidin-2-one has a molecular weight of 254.33 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylpyrrolidin-2-one;1,3-oxazolidin-2-one is sourced from PubChem (CID 174656528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).