C18H9F3O9 — CID 174656698
7-(trifluoromethoxycarbonyl)-9H-xanthene-2,3,6-tricarboxylic acid (PubChem CID 174656698) has the molecular formula C18H9F3O9 and a molecular weight of 426.26 g/mol. Its IUPAC name is 7-(trifluoromethoxycarbonyl)-9H-xanthene-2,3,6-tricarboxylic acid.
| Compound Name | 7-(trifluoromethoxycarbonyl)-9H-xanthene-2,3,6-tricarboxylic acid |
|---|---|
| PubChem CID | 174656698 |
| Molecular Formula | C18H9F3O9 |
| Molecular Weight | 426.26 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 7-(trifluoromethoxycarbonyl)-9H-xanthene-2,3,6-tricarboxylic acid |
| SMILES | O=C(O)c1cc2c(cc1C(=O)O)Oc1cc(C(=O)O)c(C(=O)OC(F)(F)F)cc1C2 |
| InChI | InChI=1S/C18H9F3O9/c19-18(20,21)30-17(28)11-3-7-1-6-2-8(14(22)23)9(15(24)25)4-12(6)29-13(7)5-10(11)16(26)27/h2-5H,1H2,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | DZSSAHVIJFFKJY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |