C18H14BF5NO3+ — CID 174657153
1-benzylpyridin-1-ium;(2,3,4,5,6-pentafluorophenoxy)boronic acid (PubChem CID 174657153) has the molecular formula C18H14BF5NO3+ and a molecular weight of 398.12 g/mol. Its IUPAC name is 1-benzylpyridin-1-ium;(2,3,4,5,6-pentafluorophenoxy)boronic acid.
| Compound Name | 1-benzylpyridin-1-ium;(2,3,4,5,6-pentafluorophenoxy)boronic acid |
|---|---|
| PubChem CID | 174657153 |
| Molecular Formula | C18H14BF5NO3+ |
| Molecular Weight | 398.12 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-benzylpyridin-1-ium;(2,3,4,5,6-pentafluorophenoxy)boronic acid |
| SMILES | OB(O)Oc1c(F)c(F)c(F)c(F)c1F.c1ccc(C[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C12H12N.C6H2BF5O3/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;8-1-2(9)4(11)6(15-7(13)14)5(12)3(1)10/h1-10H,11H2;13-14H/q+1; |
| InChIKey | GALCQMBHDGLRTE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 53.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.12 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|