About 5-hydroxypiperidine-3-carboxylic acid;toluene
5-hydroxypiperidine-3-carboxylic acid;toluene (PubChem CID 174657604) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is 5-hydroxypiperidine-3-carboxylic acid;toluene.
Molecular Properties
| Compound Name | 5-hydroxypiperidine-3-carboxylic acid;toluene |
| PubChem CID | 174657604 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 5-hydroxypiperidine-3-carboxylic acid;toluene |
| SMILES | Cc1ccccc1.O=C(O)C1CNCC(O)C1 |
| InChI | InChI=1S/C7H8.C6H11NO3/c1-7-5-3-2-4-6-7;8-5-1-4(6(9)10)2-7-3-5/h2-6H,1H3;4-5,7-8H,1-3H2,(H,9,10) |
| InChIKey | MTCLUBXFOQNQSX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-hydroxypiperidine-3-carboxylic acid;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxypiperidine-3-carboxylic acid;toluene?
The IUPAC name of 5-hydroxypiperidine-3-carboxylic acid;toluene (CID 174657604) is 5-hydroxypiperidine-3-carboxylic acid;toluene.
What is the SMILES notation for 5-hydroxypiperidine-3-carboxylic acid;toluene?
The canonical SMILES for 5-hydroxypiperidine-3-carboxylic acid;toluene is Cc1ccccc1.O=C(O)C1CNCC(O)C1.
What is the InChIKey of 5-hydroxypiperidine-3-carboxylic acid;toluene?
The InChIKey is MTCLUBXFOQNQSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8.C6H11NO3/c1-7-5-3-2-4-6-7;8-5-1-4(6(9)10)2-7-3-5/h2-6H,1H3;4-5,7-8H,1-3H2,(H,9,10).
What are the key properties of 5-hydroxypiperidine-3-carboxylic acid;toluene?
5-hydroxypiperidine-3-carboxylic acid;toluene has a molecular weight of 237.30 g/mol, XLogP of 1.04, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxypiperidine-3-carboxylic acid;toluene is sourced from PubChem (CID 174657604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).