About 2-ethyl-21,22-dihydroporphyrin;nickel
2-ethyl-21,22-dihydroporphyrin;nickel (PubChem CID 174658544) has the molecular formula C22H18N4Ni
and a molecular weight of 397.11 g/mol. Its IUPAC name is 2-ethyl-21,22-dihydroporphyrin;nickel.
Molecular Properties
| Compound Name | 2-ethyl-21,22-dihydroporphyrin;nickel |
| PubChem CID | 174658544 |
| Molecular Formula | C22H18N4Ni |
| Molecular Weight | 397.11 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 2-ethyl-21,22-dihydroporphyrin;nickel |
| SMILES | CCc1cc2cc3ccc(cc4nc(cc5nc(cc1[nH]2)C=C5)C=C4)[nH]3.[Ni] |
| InChI | InChI=1S/C22H18N4.Ni/c1-2-14-9-21-12-19-6-5-17(24-19)10-15-3-4-16(23-15)11-18-7-8-20(25-18)13-22(14)26-21;/h3-13,24,26H,2H2,1H3;/b15-10-,16-11-,17-10-,18-11-,19-12-,20-13-,21-12-,22-13-; |
| InChIKey | BBBYOYDNPTUIFY-DIFMHJIJSA-N |
| XLogP | 5.22 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.11 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-21,22-dihydroporphyrin;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-21,22-dihydroporphyrin;nickel?
The IUPAC name of 2-ethyl-21,22-dihydroporphyrin;nickel (CID 174658544) is 2-ethyl-21,22-dihydroporphyrin;nickel.
What is the SMILES notation for 2-ethyl-21,22-dihydroporphyrin;nickel?
The canonical SMILES for 2-ethyl-21,22-dihydroporphyrin;nickel is CCc1cc2cc3ccc(cc4nc(cc5nc(cc1[nH]2)C=C5)C=C4)[nH]3.[Ni].
What is the InChIKey of 2-ethyl-21,22-dihydroporphyrin;nickel?
The InChIKey is BBBYOYDNPTUIFY-DIFMHJIJSA-N. The full InChI is InChI=1S/C22H18N4.Ni/c1-2-14-9-21-12-19-6-5-17(24-19)10-15-3-4-16(23-15)11-18-7-8-20(25-18)13-22(14)26-21;/h3-13,24,26H,2H2,1H3;/b15-10-,16-11-,17-10-,18-11-,19-12-,20-13-,21-12-,22-13-;.
What are the key properties of 2-ethyl-21,22-dihydroporphyrin;nickel?
2-ethyl-21,22-dihydroporphyrin;nickel has a molecular weight of 397.11 g/mol, XLogP of 5.22, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-21,22-dihydroporphyrin;nickel is sourced from PubChem (CID 174658544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).