C23H17F2N3O2 — CID 174658726
[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl] N-[(2-fluorophenyl)methoxy]methanimidate (PubChem CID 174658726) has the molecular formula C23H17F2N3O2 and a molecular weight of 405.40 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-1-phenylpyrazol-4-yl] N-[(2-fluorophenyl)methoxy]methanimidate.
| Compound Name | [3-(4-fluorophenyl)-1-phenylpyrazol-4-yl] N-[(2-fluorophenyl)methoxy]methanimidate |
|---|---|
| PubChem CID | 174658726 |
| Molecular Formula | C23H17F2N3O2 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | [3-(4-fluorophenyl)-1-phenylpyrazol-4-yl] N-[(2-fluorophenyl)methoxy]methanimidate |
| SMILES | Fc1ccc(-c2nn(-c3ccccc3)cc2OC=NOCc2ccccc2F)cc1 |
| InChI | InChI=1S/C23H17F2N3O2/c24-19-12-10-17(11-13-19)23-22(14-28(27-23)20-7-2-1-3-8-20)29-16-26-30-15-18-6-4-5-9-21(18)25/h1-14,16H,15H2 |
| InChIKey | GYDMNZYKWQGLCM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|