About 2-amino-3-[sulfamoyl(1,3-thiazol-2-ylmethyl)amino]propanoic acid
2-amino-3-[sulfamoyl(1,3-thiazol-2-ylmethyl)amino]propanoic acid (PubChem CID 174658776) has the molecular formula C7H12N4O4S2
and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-amino-3-[sulfamoyl(1,3-thiazol-2-ylmethyl)amino]propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-[sulfamoyl(1,3-thiazol-2-ylmethyl)amino]propanoic acid |
| PubChem CID | 174658776 |
| Molecular Formula | C7H12N4O4S2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-amino-3-[sulfamoyl(1,3-thiazol-2-ylmethyl)amino]propanoic acid |
| SMILES | NC(CN(Cc1nccs1)S(N)(=O)=O)C(=O)O |
| InChI | InChI=1S/C7H12N4O4S2/c8-5(7(12)13)3-11(17(9,14)15)4-6-10-1-2-16-6/h1-2,5H,3-4,8H2,(H,12,13)(H2,9,14,15) |
| InChIKey | RMIDIVVWKPMMJE-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-3-[sulfamoyl(1,3-thiazol-2-ylmethyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[sulfamoyl(1,3-thiazol-2-ylmethyl)amino]propanoic acid?
The IUPAC name of 2-amino-3-[sulfamoyl(1,3-thiazol-2-ylmethyl)amino]propanoic acid (CID 174658776) is 2-amino-3-[sulfamoyl(1,3-thiazol-2-ylmethyl)amino]propanoic acid.
What is the SMILES notation for 2-amino-3-[sulfamoyl(1,3-thiazol-2-ylmethyl)amino]propanoic acid?
The canonical SMILES for 2-amino-3-[sulfamoyl(1,3-thiazol-2-ylmethyl)amino]propanoic acid is NC(CN(Cc1nccs1)S(N)(=O)=O)C(=O)O.
What is the InChIKey of 2-amino-3-[sulfamoyl(1,3-thiazol-2-ylmethyl)amino]propanoic acid?
The InChIKey is RMIDIVVWKPMMJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O4S2/c8-5(7(12)13)3-11(17(9,14)15)4-6-10-1-2-16-6/h1-2,5H,3-4,8H2,(H,12,13)(H2,9,14,15).
What are the key properties of 2-amino-3-[sulfamoyl(1,3-thiazol-2-ylmethyl)amino]propanoic acid?
2-amino-3-[sulfamoyl(1,3-thiazol-2-ylmethyl)amino]propanoic acid has a molecular weight of 280.33 g/mol, XLogP of -1.44, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[sulfamoyl(1,3-thiazol-2-ylmethyl)amino]propanoic acid is sourced from PubChem (CID 174658776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).