About [2-(fluoromethyl)-1,3-oxazol-4-yl] acetate
[2-(fluoromethyl)-1,3-oxazol-4-yl] acetate (PubChem CID 174658936) has the molecular formula C6H6FNO3
and a molecular weight of 159.12 g/mol. Its IUPAC name is [2-(fluoromethyl)-1,3-oxazol-4-yl] acetate.
Molecular Properties
| Compound Name | [2-(fluoromethyl)-1,3-oxazol-4-yl] acetate |
| PubChem CID | 174658936 |
| Molecular Formula | C6H6FNO3 |
| Molecular Weight | 159.12 g/mol |
| Exact Mass | 159.03 |
| IUPAC Name | [2-(fluoromethyl)-1,3-oxazol-4-yl] acetate |
| SMILES | CC(=O)Oc1coc(CF)n1 |
| InChI | InChI=1S/C6H6FNO3/c1-4(9)11-6-3-10-5(2-7)8-6/h3H,2H2,1H3 |
| InChIKey | KCJOVQVMDJQROP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.12 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(fluoromethyl)-1,3-oxazol-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(fluoromethyl)-1,3-oxazol-4-yl] acetate?
The IUPAC name of [2-(fluoromethyl)-1,3-oxazol-4-yl] acetate (CID 174658936) is [2-(fluoromethyl)-1,3-oxazol-4-yl] acetate.
What is the SMILES notation for [2-(fluoromethyl)-1,3-oxazol-4-yl] acetate?
The canonical SMILES for [2-(fluoromethyl)-1,3-oxazol-4-yl] acetate is CC(=O)Oc1coc(CF)n1.
What is the InChIKey of [2-(fluoromethyl)-1,3-oxazol-4-yl] acetate?
The InChIKey is KCJOVQVMDJQROP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FNO3/c1-4(9)11-6-3-10-5(2-7)8-6/h3H,2H2,1H3.
What are the key properties of [2-(fluoromethyl)-1,3-oxazol-4-yl] acetate?
[2-(fluoromethyl)-1,3-oxazol-4-yl] acetate has a molecular weight of 159.12 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(fluoromethyl)-1,3-oxazol-4-yl] acetate is sourced from PubChem (CID 174658936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).