About 3,4-diethylcyclopentan-1-ol;formic acid
3,4-diethylcyclopentan-1-ol;formic acid (PubChem CID 174659465) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is 3,4-diethylcyclopentan-1-ol;formic acid.
Molecular Properties
| Compound Name | 3,4-diethylcyclopentan-1-ol;formic acid |
| PubChem CID | 174659465 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 3,4-diethylcyclopentan-1-ol;formic acid |
| SMILES | CCC1CC(O)CC1CC.O=CO |
| InChI | InChI=1S/C9H18O.CH2O2/c1-3-7-5-9(10)6-8(7)4-2;2-1-3/h7-10H,3-6H2,1-2H3;1H,(H,2,3) |
| InChIKey | ZRZDLAQIXWEYHS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diethylcyclopentan-1-ol;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethylcyclopentan-1-ol;formic acid?
The IUPAC name of 3,4-diethylcyclopentan-1-ol;formic acid (CID 174659465) is 3,4-diethylcyclopentan-1-ol;formic acid.
What is the SMILES notation for 3,4-diethylcyclopentan-1-ol;formic acid?
The canonical SMILES for 3,4-diethylcyclopentan-1-ol;formic acid is CCC1CC(O)CC1CC.O=CO.
What is the InChIKey of 3,4-diethylcyclopentan-1-ol;formic acid?
The InChIKey is ZRZDLAQIXWEYHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.CH2O2/c1-3-7-5-9(10)6-8(7)4-2;2-1-3/h7-10H,3-6H2,1-2H3;1H,(H,2,3).
What are the key properties of 3,4-diethylcyclopentan-1-ol;formic acid?
3,4-diethylcyclopentan-1-ol;formic acid has a molecular weight of 188.27 g/mol, XLogP of 1.89, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethylcyclopentan-1-ol;formic acid is sourced from PubChem (CID 174659465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).