C43H44N6O3S2 — CID 174659588
1,5-diphenoxy-2,4-bis[(2R)-2-(2-pyridin-4-yl-1,3-thiazol-4-yl)piperidin-1-yl]pentan-3-one (PubChem CID 174659588) has the molecular formula C43H44N6O3S2 and a molecular weight of 757.00 g/mol. Its IUPAC name is 1,5-diphenoxy-2,4-bis[(2R)-2-(2-pyridin-4-yl-1,3-thiazol-4-yl)piperidin-1-yl]pentan-3-one.
| Compound Name | 1,5-diphenoxy-2,4-bis[(2R)-2-(2-pyridin-4-yl-1,3-thiazol-4-yl)piperidin-1-yl]pentan-3-one |
|---|---|
| PubChem CID | 174659588 |
| Molecular Formula | C43H44N6O3S2 |
| Molecular Weight | 757.00 g/mol |
| Exact Mass | 756.29 |
| IUPAC Name | 1,5-diphenoxy-2,4-bis[(2R)-2-(2-pyridin-4-yl-1,3-thiazol-4-yl)piperidin-1-yl]pentan-3-one |
| SMILES | O=C(C(COc1ccccc1)N1CCCC[C@@H]1c1csc(-c2ccncc2)n1)C(COc1ccccc1)N1CCCC[C@@H]1c1csc(-c2ccncc2)n1 |
| InChI | InChI=1S/C43H44N6O3S2/c50-41(39(27-51-33-11-3-1-4-12-33)48-25-9-7-15-37(48)35-29-53-42(46-35)31-17-21-44-22-18-31)40(28-52-34-13-5-2-6-14-34)49-26-10-8-16-38(49)36-30-54-43(47-36)32-19-23-45-24-20-32/h1-6,11-14,17-24,29-30,37-40H,7-10,15-16,25-28H2/t37-,38-,39?,40?/m1/s1 |
| InChIKey | SAANQLFQRFCJMD-SZKSMXDYSA-N |
| XLogP | 8.94 |
| TPSA | 93.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.00 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |