C11H11Cl3N4O — CID 174659700
benzene-1,2-diamine;2-ethenyl-5-(trichloromethyl)-1,3,4-oxadiazole (PubChem CID 174659700) has the molecular formula C11H11Cl3N4O and a molecular weight of 321.60 g/mol. Its IUPAC name is benzene-1,2-diamine;2-ethenyl-5-(trichloromethyl)-1,3,4-oxadiazole.
| Compound Name | benzene-1,2-diamine;2-ethenyl-5-(trichloromethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 174659700 |
| Molecular Formula | C11H11Cl3N4O |
| Molecular Weight | 321.60 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | benzene-1,2-diamine;2-ethenyl-5-(trichloromethyl)-1,3,4-oxadiazole |
| SMILES | C=Cc1nnc(C(Cl)(Cl)Cl)o1.Nc1ccccc1N |
| InChI | InChI=1S/C6H8N2.C5H3Cl3N2O/c7-5-3-1-2-4-6(5)8;1-2-3-9-10-4(11-3)5(6,7)8/h1-4H,7-8H2;2H,1H2 |
| InChIKey | WAVLNCQDXVKOIX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.60 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|