About 1-ethenylidenefluorene;1H-phenalene
1-ethenylidenefluorene;1H-phenalene (PubChem CID 174659781) has the molecular formula C28H20
and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-ethenylidenefluorene;1H-phenalene.
Molecular Properties
| Compound Name | 1-ethenylidenefluorene;1H-phenalene |
| PubChem CID | 174659781 |
| Molecular Formula | C28H20 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-ethenylidenefluorene;1H-phenalene |
| SMILES | C1=Cc2cccc3cccc(c23)C1.C=C=c1cccc2c1=Cc1ccccc1-2 |
| InChI | InChI=1S/C15H10.C13H10/c1-2-11-7-5-9-14-13-8-4-3-6-12(13)10-15(11)14;1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12/h3-10H,1H2;1-8H,9H2 |
| InChIKey | AVVUERNXJAKMLE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethenylidenefluorene;1H-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylidenefluorene;1H-phenalene?
The IUPAC name of 1-ethenylidenefluorene;1H-phenalene (CID 174659781) is 1-ethenylidenefluorene;1H-phenalene.
What is the SMILES notation for 1-ethenylidenefluorene;1H-phenalene?
The canonical SMILES for 1-ethenylidenefluorene;1H-phenalene is C1=Cc2cccc3cccc(c23)C1.C=C=c1cccc2c1=Cc1ccccc1-2.
What is the InChIKey of 1-ethenylidenefluorene;1H-phenalene?
The InChIKey is AVVUERNXJAKMLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10.C13H10/c1-2-11-7-5-9-14-13-8-4-3-6-12(13)10-15(11)14;1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12/h3-10H,1H2;1-8H,9H2.
What are the key properties of 1-ethenylidenefluorene;1H-phenalene?
1-ethenylidenefluorene;1H-phenalene has a molecular weight of 356.47 g/mol, XLogP of 5.47, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylidenefluorene;1H-phenalene is sourced from PubChem (CID 174659781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).