About 4H-1,3-benzothiazol-2-one
4H-1,3-benzothiazol-2-one (PubChem CID 174659876) has the molecular formula C7H5NOS
and a molecular weight of 151.19 g/mol. Its IUPAC name is 4H-1,3-benzothiazol-2-one.
Molecular Properties
| Compound Name | 4H-1,3-benzothiazol-2-one |
| PubChem CID | 174659876 |
| Molecular Formula | C7H5NOS |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.01 |
| IUPAC Name | 4H-1,3-benzothiazol-2-one |
| SMILES | O=C1N=C2CC=CC=C2S1 |
| InChI | InChI=1S/C7H5NOS/c9-7-8-5-3-1-2-4-6(5)10-7/h1-2,4H,3H2 |
| InChIKey | BBCOPHVHPPFSGZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4H-1,3-benzothiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-1,3-benzothiazol-2-one?
The IUPAC name of 4H-1,3-benzothiazol-2-one (CID 174659876) is 4H-1,3-benzothiazol-2-one.
What is the SMILES notation for 4H-1,3-benzothiazol-2-one?
The canonical SMILES for 4H-1,3-benzothiazol-2-one is O=C1N=C2CC=CC=C2S1.
What is the InChIKey of 4H-1,3-benzothiazol-2-one?
The InChIKey is BBCOPHVHPPFSGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NOS/c9-7-8-5-3-1-2-4-6(5)10-7/h1-2,4H,3H2.
What are the key properties of 4H-1,3-benzothiazol-2-one?
4H-1,3-benzothiazol-2-one has a molecular weight of 151.19 g/mol, XLogP of 2.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-1,3-benzothiazol-2-one is sourced from PubChem (CID 174659876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).