C46H32N4O — CID 174659974
1-(2,10,15,20-tetraphenylporphyrin-5-yl)ethanol (PubChem CID 174659974) has the molecular formula C46H32N4O and a molecular weight of 656.79 g/mol. Its IUPAC name is 1-(2,10,15,20-tetraphenylporphyrin-5-yl)ethanol.
| Compound Name | 1-(2,10,15,20-tetraphenylporphyrin-5-yl)ethanol |
|---|---|
| PubChem CID | 174659974 |
| Molecular Formula | C46H32N4O |
| Molecular Weight | 656.79 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | 1-(2,10,15,20-tetraphenylporphyrin-5-yl)ethanol |
| SMILES | CC(O)/C1=C2\C=C(c3ccccc3)C(=N2)/C(c2ccccc2)=C2/C=CC(=N2)/C(c2ccccc2)=C2/C=CC(=N2)/C(c2ccccc2)=C2/C=CC1=N2 |
| InChI | InChI=1S/C46H32N4O/c1-29(51)42-35-22-23-36(47-35)43(31-16-8-3-9-17-31)37-24-25-38(48-37)44(32-18-10-4-11-19-32)39-26-27-40(49-39)45(33-20-12-5-13-21-33)46-34(28-41(42)50-46)30-14-6-2-7-15-30/h2-29,51H,1H3/b42-35-,42-41-,43-36-,43-37-,44-38-,44-39-,45-40-,46-45- |
| InChIKey | LSWDPRUONHNNTP-MEUPLAILSA-N |
| XLogP | 9.44 |
| TPSA | 69.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.79 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |