About [1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone
[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 17465998) has the molecular formula C16H22N6O2
and a molecular weight of 330.39 g/mol. Its IUPAC name is [1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone |
| PubChem CID | 17465998 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | [1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | Cn1ncc2c(N3CCCC(C(=O)N4CCOCC4)C3)ncnc21 |
| InChI | InChI=1S/C16H22N6O2/c1-20-14-13(9-19-20)15(18-11-17-14)22-4-2-3-12(10-22)16(23)21-5-7-24-8-6-21/h9,11-12H,2-8,10H2,1H3 |
| InChIKey | DWWOCSNBEAJBBK-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone?
The IUPAC name of [1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone (CID 17465998) is [1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone is Cn1ncc2c(N3CCCC(C(=O)N4CCOCC4)C3)ncnc21.
What is the InChIKey of [1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone?
The InChIKey is DWWOCSNBEAJBBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N6O2/c1-20-14-13(9-19-20)15(18-11-17-14)22-4-2-3-12(10-22)16(23)21-5-7-24-8-6-21/h9,11-12H,2-8,10H2,1H3.
What are the key properties of [1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone?
[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone has a molecular weight of 330.39 g/mol, XLogP of 0.44, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 17465998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).