About [2-(6,6-difluoro-4-methylheptyl)sulfanyl-2-methylpropyl] 3-methylbutanoate
[2-(6,6-difluoro-4-methylheptyl)sulfanyl-2-methylpropyl] 3-methylbutanoate (PubChem CID 174660147) has the molecular formula C17H32F2O2S
and a molecular weight of 338.50 g/mol. Its IUPAC name is [2-(6,6-difluoro-4-methylheptyl)sulfanyl-2-methylpropyl] 3-methylbutanoate.
Molecular Properties
| Compound Name | [2-(6,6-difluoro-4-methylheptyl)sulfanyl-2-methylpropyl] 3-methylbutanoate |
| PubChem CID | 174660147 |
| Molecular Formula | C17H32F2O2S |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | [2-(6,6-difluoro-4-methylheptyl)sulfanyl-2-methylpropyl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OCC(C)(C)SCCCC(C)CC(C)(F)F |
| InChI | InChI=1S/C17H32F2O2S/c1-13(2)10-15(20)21-12-16(4,5)22-9-7-8-14(3)11-17(6,18)19/h13-14H,7-12H2,1-6H3 |
| InChIKey | JVGRBWKMPNEGDP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-(6,6-difluoro-4-methylheptyl)sulfanyl-2-methylpropyl] 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(6,6-difluoro-4-methylheptyl)sulfanyl-2-methylpropyl] 3-methylbutanoate?
The IUPAC name of [2-(6,6-difluoro-4-methylheptyl)sulfanyl-2-methylpropyl] 3-methylbutanoate (CID 174660147) is [2-(6,6-difluoro-4-methylheptyl)sulfanyl-2-methylpropyl] 3-methylbutanoate.
What is the SMILES notation for [2-(6,6-difluoro-4-methylheptyl)sulfanyl-2-methylpropyl] 3-methylbutanoate?
The canonical SMILES for [2-(6,6-difluoro-4-methylheptyl)sulfanyl-2-methylpropyl] 3-methylbutanoate is CC(C)CC(=O)OCC(C)(C)SCCCC(C)CC(C)(F)F.
What is the InChIKey of [2-(6,6-difluoro-4-methylheptyl)sulfanyl-2-methylpropyl] 3-methylbutanoate?
The InChIKey is JVGRBWKMPNEGDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32F2O2S/c1-13(2)10-15(20)21-12-16(4,5)22-9-7-8-14(3)11-17(6,18)19/h13-14H,7-12H2,1-6H3.
What are the key properties of [2-(6,6-difluoro-4-methylheptyl)sulfanyl-2-methylpropyl] 3-methylbutanoate?
[2-(6,6-difluoro-4-methylheptyl)sulfanyl-2-methylpropyl] 3-methylbutanoate has a molecular weight of 338.50 g/mol, XLogP of 5.55, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(6,6-difluoro-4-methylheptyl)sulfanyl-2-methylpropyl] 3-methylbutanoate is sourced from PubChem (CID 174660147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).