About 2-butan-2-yl-1,1,2-triethoxysilinane
2-butan-2-yl-1,1,2-triethoxysilinane (PubChem CID 174660627) has the molecular formula C15H32O3Si
and a molecular weight of 288.50 g/mol. Its IUPAC name is 2-butan-2-yl-1,1,2-triethoxysilinane.
Molecular Properties
| Compound Name | 2-butan-2-yl-1,1,2-triethoxysilinane |
| PubChem CID | 174660627 |
| Molecular Formula | C15H32O3Si |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 2-butan-2-yl-1,1,2-triethoxysilinane |
| SMILES | CCOC1(C(C)CC)CCCC[Si]1(OCC)OCC |
| InChI | InChI=1S/C15H32O3Si/c1-6-14(5)15(16-7-2)12-10-11-13-19(15,17-8-3)18-9-4/h14H,6-13H2,1-5H3 |
| InChIKey | KPKMURNLRCILLG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-butan-2-yl-1,1,2-triethoxysilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-1,1,2-triethoxysilinane?
The IUPAC name of 2-butan-2-yl-1,1,2-triethoxysilinane (CID 174660627) is 2-butan-2-yl-1,1,2-triethoxysilinane.
What is the SMILES notation for 2-butan-2-yl-1,1,2-triethoxysilinane?
The canonical SMILES for 2-butan-2-yl-1,1,2-triethoxysilinane is CCOC1(C(C)CC)CCCC[Si]1(OCC)OCC.
What is the InChIKey of 2-butan-2-yl-1,1,2-triethoxysilinane?
The InChIKey is KPKMURNLRCILLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O3Si/c1-6-14(5)15(16-7-2)12-10-11-13-19(15,17-8-3)18-9-4/h14H,6-13H2,1-5H3.
What are the key properties of 2-butan-2-yl-1,1,2-triethoxysilinane?
2-butan-2-yl-1,1,2-triethoxysilinane has a molecular weight of 288.50 g/mol, XLogP of 4.05, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-1,1,2-triethoxysilinane is sourced from PubChem (CID 174660627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).