About trichlorocobalt
trichlorocobalt (PubChem CID 174660789) has the molecular formula Cl6Co2
and a molecular weight of 330.58 g/mol. Its IUPAC name is trichlorocobalt.
Molecular Properties
| Compound Name | trichlorocobalt |
| PubChem CID | 174660789 |
| Molecular Formula | Cl6Co2 |
| Molecular Weight | 330.58 g/mol |
| Exact Mass | 327.68 |
| IUPAC Name | trichlorocobalt |
| SMILES | Cl[Co](Cl)Cl.Cl[Co](Cl)Cl |
| InChI | InChI=1S/6ClH.2Co/h6*1H;;/q;;;;;;2*+3/p-6 |
| InChIKey | AKUMBLVRQXQJJG-UHFFFAOYSA-H |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze trichlorocobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichlorocobalt?
The IUPAC name of trichlorocobalt (CID 174660789) is trichlorocobalt.
What is the SMILES notation for trichlorocobalt?
The canonical SMILES for trichlorocobalt is Cl[Co](Cl)Cl.Cl[Co](Cl)Cl.
What is the InChIKey of trichlorocobalt?
The InChIKey is AKUMBLVRQXQJJG-UHFFFAOYSA-H. The full InChI is InChI=1S/6ClH.2Co/h6*1H;;/q;;;;;;2*+3/p-6.
What are the key properties of trichlorocobalt?
trichlorocobalt has a molecular weight of 330.58 g/mol, XLogP of 4.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichlorocobalt is sourced from PubChem (CID 174660789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).