About 1,2-oxazole;1,3-oxazole;7H-purine
1,2-oxazole;1,3-oxazole;7H-purine (PubChem CID 174661923) has the molecular formula C11H10N6O2
and a molecular weight of 258.24 g/mol. Its IUPAC name is 1,2-oxazole;1,3-oxazole;7H-purine.
Molecular Properties
| Compound Name | 1,2-oxazole;1,3-oxazole;7H-purine |
| PubChem CID | 174661923 |
| Molecular Formula | C11H10N6O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1,2-oxazole;1,3-oxazole;7H-purine |
| SMILES | c1cnoc1.c1cocn1.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C5H4N4.2C3H3NO/c1-4-5(8-2-6-1)9-3-7-4;1-2-5-3-4-1;1-2-4-5-3-1/h1-3H,(H,6,7,8,9);2*1-3H |
| InChIKey | NREJBFSLWAYJIR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 106.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,2-oxazole;1,3-oxazole;7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-oxazole;1,3-oxazole;7H-purine?
The IUPAC name of 1,2-oxazole;1,3-oxazole;7H-purine (CID 174661923) is 1,2-oxazole;1,3-oxazole;7H-purine.
What is the SMILES notation for 1,2-oxazole;1,3-oxazole;7H-purine?
The canonical SMILES for 1,2-oxazole;1,3-oxazole;7H-purine is c1cnoc1.c1cocn1.c1ncc2[nH]cnc2n1.
What is the InChIKey of 1,2-oxazole;1,3-oxazole;7H-purine?
The InChIKey is NREJBFSLWAYJIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4.2C3H3NO/c1-4-5(8-2-6-1)9-3-7-4;1-2-5-3-4-1;1-2-4-5-3-1/h1-3H,(H,6,7,8,9);2*1-3H.
What are the key properties of 1,2-oxazole;1,3-oxazole;7H-purine?
1,2-oxazole;1,3-oxazole;7H-purine has a molecular weight of 258.24 g/mol, XLogP of 1.70, 0 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-oxazole;1,3-oxazole;7H-purine is sourced from PubChem (CID 174661923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).