About 3-methylpyridine;prop-2-ene-1-sulfonic acid
3-methylpyridine;prop-2-ene-1-sulfonic acid (PubChem CID 174662017) has the molecular formula C9H13NO3S
and a molecular weight of 215.27 g/mol. Its IUPAC name is 3-methylpyridine;prop-2-ene-1-sulfonic acid.
Molecular Properties
| Compound Name | 3-methylpyridine;prop-2-ene-1-sulfonic acid |
| PubChem CID | 174662017 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 3-methylpyridine;prop-2-ene-1-sulfonic acid |
| SMILES | C=CCS(=O)(=O)O.Cc1cccnc1 |
| InChI | InChI=1S/C6H7N.C3H6O3S/c1-6-3-2-4-7-5-6;1-2-3-7(4,5)6/h2-5H,1H3;2H,1,3H2,(H,4,5,6) |
| InChIKey | PAELLQHJQXNOBM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpyridine;prop-2-ene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpyridine;prop-2-ene-1-sulfonic acid?
The IUPAC name of 3-methylpyridine;prop-2-ene-1-sulfonic acid (CID 174662017) is 3-methylpyridine;prop-2-ene-1-sulfonic acid.
What is the SMILES notation for 3-methylpyridine;prop-2-ene-1-sulfonic acid?
The canonical SMILES for 3-methylpyridine;prop-2-ene-1-sulfonic acid is C=CCS(=O)(=O)O.Cc1cccnc1.
What is the InChIKey of 3-methylpyridine;prop-2-ene-1-sulfonic acid?
The InChIKey is PAELLQHJQXNOBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N.C3H6O3S/c1-6-3-2-4-7-5-6;1-2-3-7(4,5)6/h2-5H,1H3;2H,1,3H2,(H,4,5,6).
What are the key properties of 3-methylpyridine;prop-2-ene-1-sulfonic acid?
3-methylpyridine;prop-2-ene-1-sulfonic acid has a molecular weight of 215.27 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpyridine;prop-2-ene-1-sulfonic acid is sourced from PubChem (CID 174662017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).