About [4-[(3,5-diethylpyrazol-1-yl)methyl]cyclohexyl] N-tert-butylcarbamate
[4-[(3,5-diethylpyrazol-1-yl)methyl]cyclohexyl] N-tert-butylcarbamate (PubChem CID 174662225) has the molecular formula C19H33N3O2
and a molecular weight of 335.49 g/mol. Its IUPAC name is [4-[(3,5-diethylpyrazol-1-yl)methyl]cyclohexyl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [4-[(3,5-diethylpyrazol-1-yl)methyl]cyclohexyl] N-tert-butylcarbamate |
| PubChem CID | 174662225 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | [4-[(3,5-diethylpyrazol-1-yl)methyl]cyclohexyl] N-tert-butylcarbamate |
| SMILES | CCc1cc(CC)n(CC2CCC(OC(=O)NC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C19H33N3O2/c1-6-15-12-16(7-2)22(21-15)13-14-8-10-17(11-9-14)24-18(23)20-19(3,4)5/h12,14,17H,6-11,13H2,1-5H3,(H,20,23) |
| InChIKey | VUIVLGUNTRJWOA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(3,5-diethylpyrazol-1-yl)methyl]cyclohexyl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(3,5-diethylpyrazol-1-yl)methyl]cyclohexyl] N-tert-butylcarbamate?
The IUPAC name of [4-[(3,5-diethylpyrazol-1-yl)methyl]cyclohexyl] N-tert-butylcarbamate (CID 174662225) is [4-[(3,5-diethylpyrazol-1-yl)methyl]cyclohexyl] N-tert-butylcarbamate.
What is the SMILES notation for [4-[(3,5-diethylpyrazol-1-yl)methyl]cyclohexyl] N-tert-butylcarbamate?
The canonical SMILES for [4-[(3,5-diethylpyrazol-1-yl)methyl]cyclohexyl] N-tert-butylcarbamate is CCc1cc(CC)n(CC2CCC(OC(=O)NC(C)(C)C)CC2)n1.
What is the InChIKey of [4-[(3,5-diethylpyrazol-1-yl)methyl]cyclohexyl] N-tert-butylcarbamate?
The InChIKey is VUIVLGUNTRJWOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33N3O2/c1-6-15-12-16(7-2)22(21-15)13-14-8-10-17(11-9-14)24-18(23)20-19(3,4)5/h12,14,17H,6-11,13H2,1-5H3,(H,20,23).
What are the key properties of [4-[(3,5-diethylpyrazol-1-yl)methyl]cyclohexyl] N-tert-butylcarbamate?
[4-[(3,5-diethylpyrazol-1-yl)methyl]cyclohexyl] N-tert-butylcarbamate has a molecular weight of 335.49 g/mol, XLogP of 4.09, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(3,5-diethylpyrazol-1-yl)methyl]cyclohexyl] N-tert-butylcarbamate is sourced from PubChem (CID 174662225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).