About hexafluoroantimony(1-);hydron;zinc
hexafluoroantimony(1-);hydron;zinc (PubChem CID 174662678) has the molecular formula HF6SbZn
and a molecular weight of 302.15 g/mol. Its IUPAC name is hexafluoroantimony(1-);hydron;zinc.
Molecular Properties
| Compound Name | hexafluoroantimony(1-);hydron;zinc |
| PubChem CID | 174662678 |
| Molecular Formula | HF6SbZn |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 299.83 |
| IUPAC Name | hexafluoroantimony(1-);hydron;zinc |
| SMILES | F[Sb-](F)(F)(F)(F)F.[H+].[Zn] |
| InChI | InChI=1S/6FH.Sb.Zn/h6*1H;;/q;;;;;;+5;/p-5 |
| InChIKey | NYMNZLRBYKOXBX-UHFFFAOYSA-I |
| XLogP | 2.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hexafluoroantimony(1-);hydron;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexafluoroantimony(1-);hydron;zinc?
The IUPAC name of hexafluoroantimony(1-);hydron;zinc (CID 174662678) is hexafluoroantimony(1-);hydron;zinc.
What is the SMILES notation for hexafluoroantimony(1-);hydron;zinc?
The canonical SMILES for hexafluoroantimony(1-);hydron;zinc is F[Sb-](F)(F)(F)(F)F.[H+].[Zn].
What is the InChIKey of hexafluoroantimony(1-);hydron;zinc?
The InChIKey is NYMNZLRBYKOXBX-UHFFFAOYSA-I. The full InChI is InChI=1S/6FH.Sb.Zn/h6*1H;;/q;;;;;;+5;/p-5.
What are the key properties of hexafluoroantimony(1-);hydron;zinc?
hexafluoroantimony(1-);hydron;zinc has a molecular weight of 302.15 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexafluoroantimony(1-);hydron;zinc is sourced from PubChem (CID 174662678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).