About [1-[4-(6-chloro-5-nitro-3-phenyl-2-pyridinyl)phenyl]cyclobutyl] N-tert-butylcarbamate
[1-[4-(6-chloro-5-nitro-3-phenyl-2-pyridinyl)phenyl]cyclobutyl] N-tert-butylcarbamate (PubChem CID 174663754) has the molecular formula C26H26ClN3O4
and a molecular weight of 479.96 g/mol. Its IUPAC name is [1-[4-(6-chloro-5-nitro-3-phenyl-2-pyridinyl)phenyl]cyclobutyl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [1-[4-(6-chloro-5-nitro-3-phenyl-2-pyridinyl)phenyl]cyclobutyl] N-tert-butylcarbamate |
| PubChem CID | 174663754 |
| Molecular Formula | C26H26ClN3O4 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | [1-[4-(6-chloro-5-nitro-3-phenyl-2-pyridinyl)phenyl]cyclobutyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1(c2ccc(-c3nc(Cl)c([N+](=O)[O-])cc3-c3ccccc3)cc2)CCC1 |
| InChI | InChI=1S/C26H26ClN3O4/c1-25(2,3)29-24(31)34-26(14-7-15-26)19-12-10-18(11-13-19)22-20(17-8-5-4-6-9-17)16-21(30(32)33)23(27)28-22/h4-6,8-13,16H,7,14-15H2,1-3H3,(H,29,31) |
| InChIKey | BLTINUYQISAVCQ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-[4-(6-chloro-5-nitro-3-phenyl-2-pyridinyl)phenyl]cyclobutyl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(6-chloro-5-nitro-3-phenyl-2-pyridinyl)phenyl]cyclobutyl] N-tert-butylcarbamate?
The IUPAC name of [1-[4-(6-chloro-5-nitro-3-phenyl-2-pyridinyl)phenyl]cyclobutyl] N-tert-butylcarbamate (CID 174663754) is [1-[4-(6-chloro-5-nitro-3-phenyl-2-pyridinyl)phenyl]cyclobutyl] N-tert-butylcarbamate.
What is the SMILES notation for [1-[4-(6-chloro-5-nitro-3-phenyl-2-pyridinyl)phenyl]cyclobutyl] N-tert-butylcarbamate?
The canonical SMILES for [1-[4-(6-chloro-5-nitro-3-phenyl-2-pyridinyl)phenyl]cyclobutyl] N-tert-butylcarbamate is CC(C)(C)NC(=O)OC1(c2ccc(-c3nc(Cl)c([N+](=O)[O-])cc3-c3ccccc3)cc2)CCC1.
What is the InChIKey of [1-[4-(6-chloro-5-nitro-3-phenyl-2-pyridinyl)phenyl]cyclobutyl] N-tert-butylcarbamate?
The InChIKey is BLTINUYQISAVCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26ClN3O4/c1-25(2,3)29-24(31)34-26(14-7-15-26)19-12-10-18(11-13-19)22-20(17-8-5-4-6-9-17)16-21(30(32)33)23(27)28-22/h4-6,8-13,16H,7,14-15H2,1-3H3,(H,29,31).
What are the key properties of [1-[4-(6-chloro-5-nitro-3-phenyl-2-pyridinyl)phenyl]cyclobutyl] N-tert-butylcarbamate?
[1-[4-(6-chloro-5-nitro-3-phenyl-2-pyridinyl)phenyl]cyclobutyl] N-tert-butylcarbamate has a molecular weight of 479.96 g/mol, XLogP of 6.88, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(6-chloro-5-nitro-3-phenyl-2-pyridinyl)phenyl]cyclobutyl] N-tert-butylcarbamate is sourced from PubChem (CID 174663754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).