C35H35N5O5 — CID 174663788
(2S)-N-[4-[2-[4-[2-[acetyl(formyl)amino]pyrrolidin-1-yl]phenyl]-1,3-oxazol-5-yl]phenyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide (PubChem CID 174663788) has the molecular formula C35H35N5O5 and a molecular weight of 605.70 g/mol. Its IUPAC name is (2S)-N-[4-[2-[4-[2-[acetyl(formyl)amino]pyrrolidin-1-yl]phenyl]-1,3-oxazol-5-yl]phenyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-[2-[4-[2-[acetyl(formyl)amino]pyrrolidin-1-yl]phenyl]-1,3-oxazol-5-yl]phenyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 174663788 |
| Molecular Formula | C35H35N5O5 |
| Molecular Weight | 605.70 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | (2S)-N-[4-[2-[4-[2-[acetyl(formyl)amino]pyrrolidin-1-yl]phenyl]-1,3-oxazol-5-yl]phenyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide |
| SMILES | CC(=O)N(C=O)C1CCCN1c1ccc(-c2ncc(-c3ccc(NC(=O)[C@@H]4CCCN4C(=O)Cc4ccccc4)cc3)o2)cc1 |
| InChI | InChI=1S/C35H35N5O5/c1-24(42)40(23-41)32-10-6-19-38(32)29-17-13-27(14-18-29)35-36-22-31(45-35)26-11-15-28(16-12-26)37-34(44)30-9-5-20-39(30)33(43)21-25-7-3-2-4-8-25/h2-4,7-8,11-18,22-23,30,32H,5-6,9-10,19-21H2,1H3,(H,37,44)/t30-,32?/m0/s1 |
| InChIKey | OTABMDVEVFQDSI-TZYYSAMKSA-N |
| XLogP | 5.11 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.70 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|