C24H27N3O2 — CID 17466380
2-(1-methylidene-3-oxoisoindol-2-yl)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]acetamide (PubChem CID 17466380) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-(1-methylidene-3-oxoisoindol-2-yl)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(1-methylidene-3-oxoisoindol-2-yl)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 17466380 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 2-(1-methylidene-3-oxoisoindol-2-yl)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]acetamide |
| SMILES | C=C1c2ccccc2C(=O)N1CC(=O)NCc1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C24H27N3O2/c1-18-21-7-3-4-8-22(21)24(29)27(18)17-23(28)25-15-19-9-11-20(12-10-19)16-26-13-5-2-6-14-26/h3-4,7-12H,1-2,5-6,13-17H2,(H,25,28) |
| InChIKey | ZGVLRLTXHUZXGN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |