C22H26N4O3 — CID 174664190
tert-butyl formate;1-(1H-indol-5-yl)-3-(4-methyl-3-pyridinyl)imidazolidin-2-one (PubChem CID 174664190) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is tert-butyl formate;1-(1H-indol-5-yl)-3-(4-methyl-3-pyridinyl)imidazolidin-2-one.
| Compound Name | tert-butyl formate;1-(1H-indol-5-yl)-3-(4-methyl-3-pyridinyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 174664190 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | tert-butyl formate;1-(1H-indol-5-yl)-3-(4-methyl-3-pyridinyl)imidazolidin-2-one |
| SMILES | CC(C)(C)OC=O.Cc1ccncc1N1CCN(c2ccc3[nH]ccc3c2)C1=O |
| InChI | InChI=1S/C17H16N4O.C5H10O2/c1-12-4-6-18-11-16(12)21-9-8-20(17(21)22)14-2-3-15-13(10-14)5-7-19-15;1-5(2,3)7-4-6/h2-7,10-11,19H,8-9H2,1H3;4H,1-3H3 |
| InChIKey | PJCBKDAFHXMQAC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|