About azane;2-phenylmorpholine
azane;2-phenylmorpholine (PubChem CID 174664757) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is azane;2-phenylmorpholine.
Molecular Properties
| Compound Name | azane;2-phenylmorpholine |
| PubChem CID | 174664757 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | azane;2-phenylmorpholine |
| SMILES | N.c1ccc(C2CNCCO2)cc1 |
| InChI | InChI=1S/C10H13NO.H3N/c1-2-4-9(5-3-1)10-8-11-6-7-12-10;/h1-5,10-11H,6-8H2;1H3 |
| InChIKey | MSIJUYKSKLWKMT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 56.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;2-phenylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-phenylmorpholine?
The IUPAC name of azane;2-phenylmorpholine (CID 174664757) is azane;2-phenylmorpholine.
What is the SMILES notation for azane;2-phenylmorpholine?
The canonical SMILES for azane;2-phenylmorpholine is N.c1ccc(C2CNCCO2)cc1.
What is the InChIKey of azane;2-phenylmorpholine?
The InChIKey is MSIJUYKSKLWKMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO.H3N/c1-2-4-9(5-3-1)10-8-11-6-7-12-10;/h1-5,10-11H,6-8H2;1H3.
What are the key properties of azane;2-phenylmorpholine?
azane;2-phenylmorpholine has a molecular weight of 180.25 g/mol, XLogP of 1.51, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-phenylmorpholine is sourced from PubChem (CID 174664757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).