C16H21N5O5 — CID 174664967
(2R,3R,4S,5R)-2-[6-amino-8-(2,5-dimethyl-3H-furan-2-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 174664967) has the molecular formula C16H21N5O5 and a molecular weight of 363.37 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-8-(2,5-dimethyl-3H-furan-2-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-8-(2,5-dimethyl-3H-furan-2-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 174664967 |
| Molecular Formula | C16H21N5O5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-8-(2,5-dimethyl-3H-furan-2-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC1=CCC(C)(c2nc3c(N)ncnc3n2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)O1 |
| InChI | InChI=1S/C16H21N5O5/c1-7-3-4-16(2,26-7)15-20-9-12(17)18-6-19-13(9)21(15)14-11(24)10(23)8(5-22)25-14/h3,6,8,10-11,14,22-24H,4-5H2,1-2H3,(H2,17,18,19)/t8-,10-,11-,14-,16?/m1/s1 |
| InChIKey | LKDZXYMGQSIRCR-HTTXCKMZSA-N |
| XLogP | -0.44 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |