C16H17N7OS — CID 17466513
6-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 17466513) has the molecular formula C16H17N7OS and a molecular weight of 355.43 g/mol. Its IUPAC name is 6-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 17466513 |
| Molecular Formula | C16H17N7OS |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 6-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccccc1Nc1nc(N)nc(CSc2nnc(C3CC3)o2)n1 |
| InChI | InChI=1S/C16H17N7OS/c1-9-4-2-3-5-11(9)18-15-20-12(19-14(17)21-15)8-25-16-23-22-13(24-16)10-6-7-10/h2-5,10H,6-8H2,1H3,(H3,17,18,19,20,21) |
| InChIKey | DFWHCBOMZFUHDK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |