About 2-methoxy-4-methylfuran;morpholine
2-methoxy-4-methylfuran;morpholine (PubChem CID 174665317) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-methoxy-4-methylfuran;morpholine.
Molecular Properties
| Compound Name | 2-methoxy-4-methylfuran;morpholine |
| PubChem CID | 174665317 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 2-methoxy-4-methylfuran;morpholine |
| SMILES | C1COCCN1.COc1cc(C)co1 |
| InChI | InChI=1S/C6H8O2.C4H9NO/c1-5-3-6(7-2)8-4-5;1-3-6-4-2-5-1/h3-4H,1-2H3;5H,1-4H2 |
| InChIKey | WPJFZOOQSLGQLZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-4-methylfuran;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4-methylfuran;morpholine?
The IUPAC name of 2-methoxy-4-methylfuran;morpholine (CID 174665317) is 2-methoxy-4-methylfuran;morpholine.
What is the SMILES notation for 2-methoxy-4-methylfuran;morpholine?
The canonical SMILES for 2-methoxy-4-methylfuran;morpholine is C1COCCN1.COc1cc(C)co1.
What is the InChIKey of 2-methoxy-4-methylfuran;morpholine?
The InChIKey is WPJFZOOQSLGQLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2.C4H9NO/c1-5-3-6(7-2)8-4-5;1-3-6-4-2-5-1/h3-4H,1-2H3;5H,1-4H2.
What are the key properties of 2-methoxy-4-methylfuran;morpholine?
2-methoxy-4-methylfuran;morpholine has a molecular weight of 199.25 g/mol, XLogP of 1.20, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4-methylfuran;morpholine is sourced from PubChem (CID 174665317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).