About perylene;styrene
perylene;styrene (PubChem CID 174665389) has the molecular formula C28H20
and a molecular weight of 356.47 g/mol. Its IUPAC name is perylene;styrene.
Molecular Properties
| Compound Name | perylene;styrene |
| PubChem CID | 174665389 |
| Molecular Formula | C28H20 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | perylene;styrene |
| SMILES | C=Cc1ccccc1.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.C8H8/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;1-2-8-6-4-3-5-7-8/h1-12H;2-7H,1H2 |
| InChIKey | YGVBQYAMMAMJCF-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze perylene;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of perylene;styrene?
The IUPAC name of perylene;styrene (CID 174665389) is perylene;styrene.
What is the SMILES notation for perylene;styrene?
The canonical SMILES for perylene;styrene is C=Cc1ccccc1.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54.
What is the InChIKey of perylene;styrene?
The InChIKey is YGVBQYAMMAMJCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12.C8H8/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;1-2-8-6-4-3-5-7-8/h1-12H;2-7H,1H2.
What are the key properties of perylene;styrene?
perylene;styrene has a molecular weight of 356.47 g/mol, XLogP of 8.07, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for perylene;styrene is sourced from PubChem (CID 174665389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).