About 2-methylpropyl octane-1-sulfonate
2-methylpropyl octane-1-sulfonate (PubChem CID 174665705) has the molecular formula C12H26O3S
and a molecular weight of 250.40 g/mol. Its IUPAC name is 2-methylpropyl octane-1-sulfonate.
Molecular Properties
| Compound Name | 2-methylpropyl octane-1-sulfonate |
| PubChem CID | 174665705 |
| Molecular Formula | C12H26O3S |
| Molecular Weight | 250.40 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2-methylpropyl octane-1-sulfonate |
| SMILES | CCCCCCCCS(=O)(=O)OCC(C)C |
| InChI | InChI=1S/C12H26O3S/c1-4-5-6-7-8-9-10-16(13,14)15-11-12(2)3/h12H,4-11H2,1-3H3 |
| InChIKey | HHJZBESDOCREPU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl octane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl octane-1-sulfonate?
The IUPAC name of 2-methylpropyl octane-1-sulfonate (CID 174665705) is 2-methylpropyl octane-1-sulfonate.
What is the SMILES notation for 2-methylpropyl octane-1-sulfonate?
The canonical SMILES for 2-methylpropyl octane-1-sulfonate is CCCCCCCCS(=O)(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl octane-1-sulfonate?
The InChIKey is HHJZBESDOCREPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O3S/c1-4-5-6-7-8-9-10-16(13,14)15-11-12(2)3/h12H,4-11H2,1-3H3.
What are the key properties of 2-methylpropyl octane-1-sulfonate?
2-methylpropyl octane-1-sulfonate has a molecular weight of 250.40 g/mol, XLogP of 3.35, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl octane-1-sulfonate is sourced from PubChem (CID 174665705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).