About anthracene;2-methyloxirane
anthracene;2-methyloxirane (PubChem CID 174666283) has the molecular formula C17H16O
and a molecular weight of 236.31 g/mol. Its IUPAC name is anthracene;2-methyloxirane.
Molecular Properties
| Compound Name | anthracene;2-methyloxirane |
| PubChem CID | 174666283 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | anthracene;2-methyloxirane |
| SMILES | CC1CO1.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C3H6O/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-3-2-4-3/h1-10H;3H,2H2,1H3 |
| InChIKey | AIEDIKRGXDKBME-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze anthracene;2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;2-methyloxirane?
The IUPAC name of anthracene;2-methyloxirane (CID 174666283) is anthracene;2-methyloxirane.
What is the SMILES notation for anthracene;2-methyloxirane?
The canonical SMILES for anthracene;2-methyloxirane is CC1CO1.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;2-methyloxirane?
The InChIKey is AIEDIKRGXDKBME-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C3H6O/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-3-2-4-3/h1-10H;3H,2H2,1H3.
What are the key properties of anthracene;2-methyloxirane?
anthracene;2-methyloxirane has a molecular weight of 236.31 g/mol, XLogP of 4.40, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;2-methyloxirane is sourced from PubChem (CID 174666283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).