C25H18Cl2F2N4O — CID 174666374
1,5-bis(2-chloropyrimidin-4-yl)-2,4-bis(4-fluorophenyl)pentan-3-one (PubChem CID 174666374) has the molecular formula C25H18Cl2F2N4O and a molecular weight of 499.35 g/mol. Its IUPAC name is 1,5-bis(2-chloropyrimidin-4-yl)-2,4-bis(4-fluorophenyl)pentan-3-one.
| Compound Name | 1,5-bis(2-chloropyrimidin-4-yl)-2,4-bis(4-fluorophenyl)pentan-3-one |
|---|---|
| PubChem CID | 174666374 |
| Molecular Formula | C25H18Cl2F2N4O |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 1,5-bis(2-chloropyrimidin-4-yl)-2,4-bis(4-fluorophenyl)pentan-3-one |
| SMILES | O=C(C(Cc1ccnc(Cl)n1)c1ccc(F)cc1)C(Cc1ccnc(Cl)n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H18Cl2F2N4O/c26-24-30-11-9-19(32-24)13-21(15-1-5-17(28)6-2-15)23(34)22(16-3-7-18(29)8-4-16)14-20-10-12-31-25(27)33-20/h1-12,21-22H,13-14H2 |
| InChIKey | BVFCMWJZZNNJKU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |