About 1,2-dimethylcyclopenta-1,3-diene;zirconium
1,2-dimethylcyclopenta-1,3-diene;zirconium (PubChem CID 174666436) has the molecular formula C7H10Zr
and a molecular weight of 185.38 g/mol. Its IUPAC name is 1,2-dimethylcyclopenta-1,3-diene;zirconium.
Molecular Properties
| Compound Name | 1,2-dimethylcyclopenta-1,3-diene;zirconium |
| PubChem CID | 174666436 |
| Molecular Formula | C7H10Zr |
| Molecular Weight | 185.38 g/mol |
| Exact Mass | 183.98 |
| IUPAC Name | 1,2-dimethylcyclopenta-1,3-diene;zirconium |
| SMILES | CC1=C(C)CC=C1.[Zr] |
| InChI | InChI=1S/C7H10.Zr/c1-6-4-3-5-7(6)2;/h3-4H,5H2,1-2H3; |
| InChIKey | ZUBUYMXCSROTGB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-dimethylcyclopenta-1,3-diene;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylcyclopenta-1,3-diene;zirconium?
The IUPAC name of 1,2-dimethylcyclopenta-1,3-diene;zirconium (CID 174666436) is 1,2-dimethylcyclopenta-1,3-diene;zirconium.
What is the SMILES notation for 1,2-dimethylcyclopenta-1,3-diene;zirconium?
The canonical SMILES for 1,2-dimethylcyclopenta-1,3-diene;zirconium is CC1=C(C)CC=C1.[Zr].
What is the InChIKey of 1,2-dimethylcyclopenta-1,3-diene;zirconium?
The InChIKey is ZUBUYMXCSROTGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10.Zr/c1-6-4-3-5-7(6)2;/h3-4H,5H2,1-2H3;.
What are the key properties of 1,2-dimethylcyclopenta-1,3-diene;zirconium?
1,2-dimethylcyclopenta-1,3-diene;zirconium has a molecular weight of 185.38 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylcyclopenta-1,3-diene;zirconium is sourced from PubChem (CID 174666436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).